C23H39ClN8O6 — CID 59641707
3,5-diamino-6-chloro-N-[N'-[4-[4-[(2R)-2-hydroxy-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]piperidin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 59641707) has the molecular formula C23H39ClN8O6 and a molecular weight of 559.07 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2R)-2-hydroxy-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]piperidin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2R)-2-hydroxy-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]piperidin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59641707 |
| Molecular Formula | C23H39ClN8O6 |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2R)-2-hydroxy-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]piperidin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CC1(C)O[C@H]([C@H](O)COC2CCN(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)CC2)[C@H](CO)O1 |
| InChI | InChI=1S/C23H39ClN8O6/c1-23(2)37-15(11-33)17(38-23)14(34)12-36-13-5-9-32(10-6-13)8-4-3-7-28-22(27)31-21(35)16-19(25)30-20(26)18(24)29-16/h13-15,17,33-34H,3-12H2,1-2H3,(H4,25,26,30)(H3,27,28,31,35)/t14-,15+,17-/m1/s1 |
| InChIKey | KMABHZIGCVPUEH-HLLBOEOZSA-N |
| XLogP | -0.53 |
| TPSA | 216.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|