C24H41ClN8O5 — CID 59641728
3,5-diamino-6-chloro-N-[N'-[4-[4-[(2R)-2-[(4R,5S)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]piperidin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 59641728) has the molecular formula C24H41ClN8O5 and a molecular weight of 557.10 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2R)-2-[(4R,5S)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]piperidin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2R)-2-[(4R,5S)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]piperidin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59641728 |
| Molecular Formula | C24H41ClN8O5 |
| Molecular Weight | 557.10 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2R)-2-[(4R,5S)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]piperidin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CC[C@@H]1OC(C)(C)O[C@@H]1[C@H](O)COC1CCN(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1 |
| InChI | InChI=1S/C24H41ClN8O5/c1-4-16-18(38-24(2,3)37-16)15(34)13-36-14-7-11-33(12-8-14)10-6-5-9-29-23(28)32-22(35)17-20(26)31-21(27)19(25)30-17/h14-16,18,34H,4-13H2,1-3H3,(H4,26,27,31)(H3,28,29,32,35)/t15-,16+,18-/m1/s1 |
| InChIKey | ZOZOGZHRFXAJMQ-SOLBZPMBSA-N |
| XLogP | 0.89 |
| TPSA | 196.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.10 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|