C24H52N2O4 — CID 59642201
1-(2-ethylhexylamino)-3-[2-[3-(2-ethylhexylamino)-2-hydroxypropoxy]ethoxy]propan-2-ol (PubChem CID 59642201) has the molecular formula C24H52N2O4 and a molecular weight of 432.69 g/mol. Its IUPAC name is 1-(2-ethylhexylamino)-3-[2-[3-(2-ethylhexylamino)-2-hydroxypropoxy]ethoxy]propan-2-ol.
| Compound Name | 1-(2-ethylhexylamino)-3-[2-[3-(2-ethylhexylamino)-2-hydroxypropoxy]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 59642201 |
| Molecular Formula | C24H52N2O4 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.39 |
| IUPAC Name | 1-(2-ethylhexylamino)-3-[2-[3-(2-ethylhexylamino)-2-hydroxypropoxy]ethoxy]propan-2-ol |
| SMILES | CCCCC(CC)CNCC(O)COCCOCC(O)CNCC(CC)CCCC |
| InChI | InChI=1S/C24H52N2O4/c1-5-9-11-21(7-3)15-25-17-23(27)19-29-13-14-30-20-24(28)18-26-16-22(8-4)12-10-6-2/h21-28H,5-20H2,1-4H3 |
| InChIKey | NPWSUFFPDDGAML-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|