About 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one
6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one (PubChem CID 596427) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one |
| PubChem CID | 596427 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one |
| SMILES | CC1=CN2CCN=C2N(C)C1=O |
| InChI | InChI=1S/C8H11N3O/c1-6-5-11-4-3-9-8(11)10(2)7(6)12/h5H,3-4H2,1-2H3 |
| InChIKey | NOJQYBVLVQZVOA-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one?
The IUPAC name of 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one (CID 596427) is 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one.
What is the SMILES notation for 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one?
The canonical SMILES for 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one is CC1=CN2CCN=C2N(C)C1=O.
What is the InChIKey of 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one?
The InChIKey is NOJQYBVLVQZVOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-6-5-11-4-3-9-8(11)10(2)7(6)12/h5H,3-4H2,1-2H3.
What are the key properties of 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one?
6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one has a molecular weight of 165.20 g/mol, XLogP of 0.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one is sourced from PubChem (CID 596427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).