About spiro[benzo[b][1]benzosilole-5,1'-silole]
spiro[benzo[b][1]benzosilole-5,1'-silole] (PubChem CID 59642906) has the molecular formula C16H12Si
and a molecular weight of 232.36 g/mol. Its IUPAC name is spiro[benzo[b][1]benzosilole-5,1'-silole].
Molecular Properties
| Compound Name | spiro[benzo[b][1]benzosilole-5,1'-silole] |
| PubChem CID | 59642906 |
| Molecular Formula | C16H12Si |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | spiro[benzo[b][1]benzosilole-5,1'-silole] |
| SMILES | C1=C[Si]2(C=C1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C16H12Si/c1-3-9-15-13(7-1)14-8-2-4-10-16(14)17(15)11-5-6-12-17/h1-12H |
| InChIKey | DBHHPXRAGLCLSN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze spiro[benzo[b][1]benzosilole-5,1'-silole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[benzo[b][1]benzosilole-5,1'-silole]?
The IUPAC name of spiro[benzo[b][1]benzosilole-5,1'-silole] (CID 59642906) is spiro[benzo[b][1]benzosilole-5,1'-silole].
What is the SMILES notation for spiro[benzo[b][1]benzosilole-5,1'-silole]?
The canonical SMILES for spiro[benzo[b][1]benzosilole-5,1'-silole] is C1=C[Si]2(C=C1)c1ccccc1-c1ccccc12.
What is the InChIKey of spiro[benzo[b][1]benzosilole-5,1'-silole]?
The InChIKey is DBHHPXRAGLCLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Si/c1-3-9-15-13(7-1)14-8-2-4-10-16(14)17(15)11-5-6-12-17/h1-12H.
What are the key properties of spiro[benzo[b][1]benzosilole-5,1'-silole]?
spiro[benzo[b][1]benzosilole-5,1'-silole] has a molecular weight of 232.36 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[benzo[b][1]benzosilole-5,1'-silole] is sourced from PubChem (CID 59642906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).