About 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium
2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium (PubChem CID 59643904) has the molecular formula C13H20N+
and a molecular weight of 190.31 g/mol. Its IUPAC name is 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium.
Molecular Properties
| Compound Name | 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium |
| PubChem CID | 59643904 |
| Molecular Formula | C13H20N+ |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium |
| SMILES | CC(C)[N+]1(C)CCc2ccccc2C1 |
| InChI | InChI=1S/C13H20N/c1-11(2)14(3)9-8-12-6-4-5-7-13(12)10-14/h4-7,11H,8-10H2,1-3H3/q+1 |
| InChIKey | HCWJRCAVJKNMKR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium?
The IUPAC name of 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium (CID 59643904) is 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium.
What is the SMILES notation for 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium?
The canonical SMILES for 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium is CC(C)[N+]1(C)CCc2ccccc2C1.
What is the InChIKey of 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium?
The InChIKey is HCWJRCAVJKNMKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N/c1-11(2)14(3)9-8-12-6-4-5-7-13(12)10-14/h4-7,11H,8-10H2,1-3H3/q+1.
What are the key properties of 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium?
2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium has a molecular weight of 190.31 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-propan-2-yl-3,4-dihydro-1H-isoquinolin-2-ium is sourced from PubChem (CID 59643904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).