About 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione
1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione (PubChem CID 59643910) has the molecular formula C21H20FNO4
and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione.
Molecular Properties
| Compound Name | 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione |
| PubChem CID | 59643910 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FNO4/c22-17-11-9-16(10-12-17)19(24)7-4-8-20(25)23-18(14-27-21(23)26)13-15-5-2-1-3-6-15/h1-3,5-6,9-12,18H,4,7-8,13-14H2/t18-/m0/s1 |
| InChIKey | BMEMZSFBFGAIFO-SFHVURJKSA-N |
| XLogP | 3.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione?
The IUPAC name of 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione (CID 59643910) is 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione.
What is the SMILES notation for 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione?
The canonical SMILES for 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione is O=C(CCCC(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)c1ccc(F)cc1.
What is the InChIKey of 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione?
The InChIKey is BMEMZSFBFGAIFO-SFHVURJKSA-N. The full InChI is InChI=1S/C21H20FNO4/c22-17-11-9-16(10-12-17)19(24)7-4-8-20(25)23-18(14-27-21(23)26)13-15-5-2-1-3-6-15/h1-3,5-6,9-12,18H,4,7-8,13-14H2/t18-/m0/s1.
What are the key properties of 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione?
1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione has a molecular weight of 369.39 g/mol, XLogP of 3.77, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-(4-fluorophenyl)pentane-1,5-dione is sourced from PubChem (CID 59643910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).