C12H9ClN2O — CID 59643997
9-chloro-6,11-dihydropyrido[2,3-b][4,1]benzoxazepine (PubChem CID 59643997) has the molecular formula C12H9ClN2O and a molecular weight of 232.67 g/mol. Its IUPAC name is 9-chloro-6,11-dihydropyrido[2,3-b][4,1]benzoxazepine.
| Compound Name | 9-chloro-6,11-dihydropyrido[2,3-b][4,1]benzoxazepine |
|---|---|
| PubChem CID | 59643997 |
| Molecular Formula | C12H9ClN2O |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 9-chloro-6,11-dihydropyrido[2,3-b][4,1]benzoxazepine |
| SMILES | Clc1ccc2c(c1)Nc1ncccc1OC2 |
| InChI | InChI=1S/C12H9ClN2O/c13-9-4-3-8-7-16-11-2-1-5-14-12(11)15-10(8)6-9/h1-6H,7H2,(H,14,15) |
| InChIKey | OVHUGKZKNBBUSP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |