About 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine
2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine (PubChem CID 59644002) has the molecular formula C12H9FN2O
and a molecular weight of 216.22 g/mol. Its IUPAC name is 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine.
Molecular Properties
| Compound Name | 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine |
| PubChem CID | 59644002 |
| Molecular Formula | C12H9FN2O |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine |
| SMILES | Fc1cnc2c(c1)Nc1ccccc1OC2 |
| InChI | InChI=1S/C12H9FN2O/c13-8-5-10-11(14-6-8)7-16-12-4-2-1-3-9(12)15-10/h1-6,15H,7H2 |
| InChIKey | IAZOBCRTTMYFEN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine?
The IUPAC name of 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine (CID 59644002) is 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine.
What is the SMILES notation for 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine?
The canonical SMILES for 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine is Fc1cnc2c(c1)Nc1ccccc1OC2.
What is the InChIKey of 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine?
The InChIKey is IAZOBCRTTMYFEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2O/c13-8-5-10-11(14-6-8)7-16-12-4-2-1-3-9(12)15-10/h1-6,15H,7H2.
What are the key properties of 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine?
2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine has a molecular weight of 216.22 g/mol, XLogP of 2.86, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5,11-dihydropyrido[2,3-c][1,5]benzoxazepine is sourced from PubChem (CID 59644002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).