C21H31NO5S — CID 59644038
(4S)-4-[(1R,4Z,8Z,10S,13R,15R)-15-hydroxy-5,10-dimethyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-1,3-thiazinan-2-one (PubChem CID 59644038) has the molecular formula C21H31NO5S and a molecular weight of 409.55 g/mol. Its IUPAC name is (4S)-4-[(1R,4Z,8Z,10S,13R,15R)-15-hydroxy-5,10-dimethyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-1,3-thiazinan-2-one.
| Compound Name | (4S)-4-[(1R,4Z,8Z,10S,13R,15R)-15-hydroxy-5,10-dimethyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-1,3-thiazinan-2-one |
|---|---|
| PubChem CID | 59644038 |
| Molecular Formula | C21H31NO5S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (4S)-4-[(1R,4Z,8Z,10S,13R,15R)-15-hydroxy-5,10-dimethyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-1,3-thiazinan-2-one |
| SMILES | C/C1=C/C(=O)O[C@@H]2C[C@@H](CC[C@H](C)/C=C\CC1)O[C@@](O)([C@@H]1CCSC(=O)N1)C2 |
| InChI | InChI=1S/C21H31NO5S/c1-14-5-3-4-6-15(2)11-19(23)26-17-12-16(8-7-14)27-21(25,13-17)18-9-10-28-20(24)22-18/h3,5,11,14,16-18,25H,4,6-10,12-13H2,1-2H3,(H,22,24)/b5-3-,15-11-/t14-,16-,17-,18+,21-/m1/s1 |
| InChIKey | IPRNJWSUQREIHP-YAZBUJTOSA-N |
| XLogP | 3.69 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|