C21H29NO5S — CID 59644091
(4R)-4-[(1R,4Z,8E,10Z,15R,17R)-17-hydroxy-5-methyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one (PubChem CID 59644091) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is (4R)-4-[(1R,4Z,8E,10Z,15R,17R)-17-hydroxy-5-methyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-[(1R,4Z,8E,10Z,15R,17R)-17-hydroxy-5-methyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 59644091 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (4R)-4-[(1R,4Z,8E,10Z,15R,17R)-17-hydroxy-5-methyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one |
| SMILES | C/C1=C/C(=O)O[C@@H]2C[C@@H](CCC/C=C\C=C\CC1)O[C@@](O)([C@@H]1CSC(=O)N1)C2 |
| InChI | InChI=1S/C21H29NO5S/c1-15-9-7-5-3-2-4-6-8-10-16-12-17(26-19(23)11-15)13-21(25,27-16)18-14-28-20(24)22-18/h2-5,11,16-18,25H,6-10,12-14H2,1H3,(H,22,24)/b4-2-,5-3+,15-11-/t16-,17-,18+,21-/m1/s1 |
| InChIKey | OVJLCUFKNIECBS-VMZPOZHSSA-N |
| XLogP | 3.61 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|