C25H28F3N3O — CID 59644155
2-methyl-N-[3-(3-piperidin-1-ylpropoxy)-5-(trifluoromethyl)phenyl]quinolin-4-amine (PubChem CID 59644155) has the molecular formula C25H28F3N3O and a molecular weight of 443.51 g/mol. Its IUPAC name is 2-methyl-N-[3-(3-piperidin-1-ylpropoxy)-5-(trifluoromethyl)phenyl]quinolin-4-amine.
| Compound Name | 2-methyl-N-[3-(3-piperidin-1-ylpropoxy)-5-(trifluoromethyl)phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 59644155 |
| Molecular Formula | C25H28F3N3O |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-methyl-N-[3-(3-piperidin-1-ylpropoxy)-5-(trifluoromethyl)phenyl]quinolin-4-amine |
| SMILES | Cc1cc(Nc2cc(OCCCN3CCCCC3)cc(C(F)(F)F)c2)c2ccccc2n1 |
| InChI | InChI=1S/C25H28F3N3O/c1-18-14-24(22-8-3-4-9-23(22)29-18)30-20-15-19(25(26,27)28)16-21(17-20)32-13-7-12-31-10-5-2-6-11-31/h3-4,8-9,14-17H,2,5-7,10-13H2,1H3,(H,29,30) |
| InChIKey | WZCIVSROCZQUDX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|