C25H29N3O3 — CID 59644216
4-methyl-1-[2-[3-[(2-methylquinolin-4-yl)amino]phenoxy]ethyl]piperidine-4-carboxylic acid (PubChem CID 59644216) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-methyl-1-[2-[3-[(2-methylquinolin-4-yl)amino]phenoxy]ethyl]piperidine-4-carboxylic acid.
| Compound Name | 4-methyl-1-[2-[3-[(2-methylquinolin-4-yl)amino]phenoxy]ethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 59644216 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 4-methyl-1-[2-[3-[(2-methylquinolin-4-yl)amino]phenoxy]ethyl]piperidine-4-carboxylic acid |
| SMILES | Cc1cc(Nc2cccc(OCCN3CCC(C)(C(=O)O)CC3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C25H29N3O3/c1-18-16-23(21-8-3-4-9-22(21)26-18)27-19-6-5-7-20(17-19)31-15-14-28-12-10-25(2,11-13-28)24(29)30/h3-9,16-17H,10-15H2,1-2H3,(H,26,27)(H,29,30) |
| InChIKey | MLBZINHPOQKVCH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |