C19H19BrN4O2 — CID 59644842
methyl N-[3-[[7-(3-bromophenyl)-1,6-naphthyridin-5-yl]amino]propyl]carbamate (PubChem CID 59644842) has the molecular formula C19H19BrN4O2 and a molecular weight of 415.29 g/mol. Its IUPAC name is methyl N-[3-[[7-(3-bromophenyl)-1,6-naphthyridin-5-yl]amino]propyl]carbamate.
| Compound Name | methyl N-[3-[[7-(3-bromophenyl)-1,6-naphthyridin-5-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 59644842 |
| Molecular Formula | C19H19BrN4O2 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | methyl N-[3-[[7-(3-bromophenyl)-1,6-naphthyridin-5-yl]amino]propyl]carbamate |
| SMILES | COC(=O)NCCCNc1nc(-c2cccc(Br)c2)cc2ncccc12 |
| InChI | InChI=1S/C19H19BrN4O2/c1-26-19(25)23-10-4-9-22-18-15-7-3-8-21-17(15)12-16(24-18)13-5-2-6-14(20)11-13/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ODWJZQOMCROXAY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|