C4H10O4 — CID 59644967
2-(hydroxymethoxy)propane-1,3-diol (PubChem CID 59644967) has the molecular formula C4H10O4 and a molecular weight of 122.12 g/mol. Its IUPAC name is 2-(hydroxymethoxy)propane-1,3-diol.
| Compound Name | 2-(hydroxymethoxy)propane-1,3-diol |
|---|---|
| PubChem CID | 59644967 |
| Molecular Formula | C4H10O4 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 2-(hydroxymethoxy)propane-1,3-diol |
| SMILES | OCOC(CO)CO |
| InChI | InChI=1S/C4H10O4/c5-1-4(2-6)8-3-7/h4-7H,1-3H2 |
| InChIKey | BUECRGWQCPOMEX-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|