About [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid
[(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid (PubChem CID 59645161) has the molecular formula C17H20BNO4
and a molecular weight of 313.16 g/mol. Its IUPAC name is [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid.
Molecular Properties
| Compound Name | [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid |
| PubChem CID | 59645161 |
| Molecular Formula | C17H20BNO4 |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid |
| SMILES | COC(=O)[C@@H]1C[C@@H](Oc2cccc3ccccc23)CN1B(C)O |
| InChI | InChI=1S/C17H20BNO4/c1-18(21)19-11-13(10-15(19)17(20)22-2)23-16-9-5-7-12-6-3-4-8-14(12)16/h3-9,13,15,21H,10-11H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | NQWXYTDPEBSYBR-HIFRSBDPSA-N |
| XLogP | 1.94 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid?
The IUPAC name of [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid (CID 59645161) is [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid.
What is the SMILES notation for [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid?
The canonical SMILES for [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid is COC(=O)[C@@H]1C[C@@H](Oc2cccc3ccccc23)CN1B(C)O.
What is the InChIKey of [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid?
The InChIKey is NQWXYTDPEBSYBR-HIFRSBDPSA-N. The full InChI is InChI=1S/C17H20BNO4/c1-18(21)19-11-13(10-15(19)17(20)22-2)23-16-9-5-7-12-6-3-4-8-14(12)16/h3-9,13,15,21H,10-11H2,1-2H3/t13-,15+/m1/s1.
What are the key properties of [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid?
[(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid has a molecular weight of 313.16 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R)-2-methoxycarbonyl-4-naphthalen-1-yloxypyrrolidin-1-yl]-methylborinic acid is sourced from PubChem (CID 59645161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).