C33H25ClFN3O7 — CID 59645180
[(2R,3R,4R)-3,4-dibenzoyloxy-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 59645180) has the molecular formula C33H25ClFN3O7 and a molecular weight of 630.03 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-dibenzoyloxy-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R)-3,4-dibenzoyloxy-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 59645180 |
| Molecular Formula | C33H25ClFN3O7 |
| Molecular Weight | 630.03 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | [(2R,3R,4R)-3,4-dibenzoyloxy-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@]1(OC(=O)c2ccccc2)C(n2cc(F)c3c(Cl)ncnc32)O[C@H](COC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H25ClFN3O7/c1-33(45-31(41)22-15-9-4-10-16-22)26(44-30(40)21-13-7-3-8-14-21)24(18-42-29(39)20-11-5-2-6-12-20)43-32(33)38-17-23(35)25-27(34)36-19-37-28(25)38/h2-17,19,24,26,32H,18H2,1H3/t24-,26-,32?,33-/m1/s1 |
| InChIKey | YWMFVCYQAYFUME-BMISYPEQSA-N |
| XLogP | 5.82 |
| TPSA | 118.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.03 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|