About 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine
7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine (PubChem CID 59645205) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine.
Analyze 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine?
The IUPAC name of 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine (CID 59645205) is 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine.
What is the SMILES notation for 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine?
The canonical SMILES for 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine is CC1=CC2OCCCOC2C=C1.
What is the InChIKey of 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine?
The InChIKey is XFGRFCFEKKQOHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-8-3-4-9-10(7-8)12-6-2-5-11-9/h3-4,7,9-10H,2,5-6H2,1H3.
What are the key properties of 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine?
7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine has a molecular weight of 166.22 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine is sourced from PubChem (CID 59645205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).