About CID 59645695
CID 59645695 (PubChem CID 59645695) has the molecular formula C20H17F3N8Pt
and a molecular weight of 621.48 g/mol.
Molecular Properties
| Compound Name | CID 59645695 |
| PubChem CID | 59645695 |
| Molecular Formula | C20H17F3N8Pt |
| Molecular Weight | 621.48 g/mol |
| Exact Mass | 621.12 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1n[c-]n(-c2cccc(Cc3cccc(-c4nc(C(F)(F)F)n[n-]4)n3)n2)n1.[Pt+2] |
| InChI | InChI=1S/C20H17F3N8.Pt/c1-19(2,3)17-24-11-31(30-17)15-9-5-7-13(26-15)10-12-6-4-8-14(25-12)16-27-18(29-28-16)20(21,22)23;/h4-9H,10H2,1-3H3;/q-2;+2 |
| InChIKey | HTBBSRLRFSPCSV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 621.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59645695 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59645695?
The IUPAC name of CID 59645695 (CID 59645695) is not available.
What is the SMILES notation for CID 59645695?
The canonical SMILES for CID 59645695 is CC(C)(C)c1n[c-]n(-c2cccc(Cc3cccc(-c4nc(C(F)(F)F)n[n-]4)n3)n2)n1.[Pt+2].
What is the InChIKey of CID 59645695?
The InChIKey is HTBBSRLRFSPCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3N8.Pt/c1-19(2,3)17-24-11-31(30-17)15-9-5-7-13(26-15)10-12-6-4-8-14(25-12)16-27-18(29-28-16)20(21,22)23;/h4-9H,10H2,1-3H3;/q-2;+2.
What are the key properties of CID 59645695?
CID 59645695 has a molecular weight of 621.48 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59645695 is sourced from PubChem (CID 59645695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).