C20H16F2N2OS — CID 59645878
6-[2-[6-(2,4-difluorophenyl)-2-pyridinyl]propan-2-yl]pyridine-2-carbothioic S-acid (PubChem CID 59645878) has the molecular formula C20H16F2N2OS and a molecular weight of 370.42 g/mol. Its IUPAC name is 6-[2-[6-(2,4-difluorophenyl)-2-pyridinyl]propan-2-yl]pyridine-2-carbothioic S-acid.
| Compound Name | 6-[2-[6-(2,4-difluorophenyl)-2-pyridinyl]propan-2-yl]pyridine-2-carbothioic S-acid |
|---|---|
| PubChem CID | 59645878 |
| Molecular Formula | C20H16F2N2OS |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 6-[2-[6-(2,4-difluorophenyl)-2-pyridinyl]propan-2-yl]pyridine-2-carbothioic S-acid |
| SMILES | CC(C)(c1cccc(C(=O)S)n1)c1cccc(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C20H16F2N2OS/c1-20(2,18-8-4-6-16(24-18)19(25)26)17-7-3-5-15(23-17)13-10-9-12(21)11-14(13)22/h3-11H,1-2H3,(H,25,26) |
| InChIKey | WJHGGMSXRFLWAX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|