C40H26F5N3Pt — CID 59645957
2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)-6-[2-[6-[diphenyl-[3-(trifluoromethyl)benzene-6-id-1-yl]methyl]-2-pyridinyl]propan-2-yl]pyridine;platinum(2+) (PubChem CID 59645957) has the molecular formula C40H26F5N3Pt and a molecular weight of 838.74 g/mol. Its IUPAC name is 2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)-6-[2-[6-[diphenyl-[3-(trifluoromethyl)benzene-6-id-1-yl]methyl]-2-pyridinyl]propan-2-yl]pyridine;platinum(2+).
| Compound Name | 2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)-6-[2-[6-[diphenyl-[3-(trifluoromethyl)benzene-6-id-1-yl]methyl]-2-pyridinyl]propan-2-yl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 59645957 |
| Molecular Formula | C40H26F5N3Pt |
| Molecular Weight | 838.74 g/mol |
| Exact Mass | 838.17 |
| IUPAC Name | 2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)-6-[2-[6-[diphenyl-[3-(trifluoromethyl)benzene-6-id-1-yl]methyl]-2-pyridinyl]propan-2-yl]pyridine;platinum(2+) |
| SMILES | [C-]#[N+]c1c(F)c[c-]c(-c2cccc(C(C)(C)c3cccc(C(c4[c-]ccc(C(F)(F)F)c4)(c4ccccc4)c4ccccc4)n3)n2)c1F.[Pt+2] |
| InChI | InChI=1S/C40H26F5N3.Pt/c1-38(2,33-20-11-19-32(47-33)30-23-24-31(41)37(46-3)36(30)42)34-21-12-22-35(48-34)39(26-13-6-4-7-14-26,27-15-8-5-9-16-27)28-17-10-18-29(25-28)40(43,44)45;/h4-16,18-22,24-25H,1-2H3;/q-2;+2 |
| InChIKey | QDYWPQPXTICZBO-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.74 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|