C23H12F4N2Pt — CID 59646058
2-(2,4-difluorobenzene-6-id-1-yl)-6-[difluoro-(6-phenyl-2-pyridinyl)methyl]pyridine;platinum(2+) (PubChem CID 59646058) has the molecular formula C23H12F4N2Pt and a molecular weight of 587.43 g/mol. Its IUPAC name is 2-(2,4-difluorobenzene-6-id-1-yl)-6-[difluoro-(6-phenyl-2-pyridinyl)methyl]pyridine;platinum(2+).
| Compound Name | 2-(2,4-difluorobenzene-6-id-1-yl)-6-[difluoro-(6-phenyl-2-pyridinyl)methyl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 59646058 |
| Molecular Formula | C23H12F4N2Pt |
| Molecular Weight | 587.43 g/mol |
| Exact Mass | 587.06 |
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)-6-[difluoro-(6-phenyl-2-pyridinyl)methyl]pyridine;platinum(2+) |
| SMILES | Fc1c[c-]c(-c2cccc(C(F)(F)c3cccc(-c4[c-]cccc4)n3)n2)c(F)c1.[Pt+2] |
| InChI | InChI=1S/C23H12F4N2.Pt/c24-16-12-13-17(18(25)14-16)20-9-5-11-22(29-20)23(26,27)21-10-4-8-19(28-21)15-6-2-1-3-7-15;/h1-6,8-12,14H;/q-2;+2 |
| InChIKey | KWEUGJSQZIDPAG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|