About 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten
2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten (PubChem CID 59646270) has the molecular formula C10H14NW2-
and a molecular weight of 515.91 g/mol. Its IUPAC name is 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten.
Molecular Properties
| Compound Name | 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten |
| PubChem CID | 59646270 |
| Molecular Formula | C10H14NW2- |
| Molecular Weight | 515.91 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten |
| SMILES | Cc1[c-]c(N)c(C)c(C)c1C.[W].[W] |
| InChI | InChI=1S/C10H14N.2W/c1-6-5-10(11)9(4)8(3)7(6)2;;/h11H2,1-4H3;;/q-1;; |
| InChIKey | PETZQRKEGGSGLF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.91 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten?
The IUPAC name of 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten (CID 59646270) is 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten.
What is the SMILES notation for 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten?
The canonical SMILES for 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten is Cc1[c-]c(N)c(C)c(C)c1C.[W].[W].
What is the InChIKey of 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten?
The InChIKey is PETZQRKEGGSGLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N.2W/c1-6-5-10(11)9(4)8(3)7(6)2;;/h11H2,1-4H3;;/q-1;;.
What are the key properties of 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten?
2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten has a molecular weight of 515.91 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetramethylbenzene-6-id-1-amine;tungsten is sourced from PubChem (CID 59646270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).