C23H24ClFN2O3 — CID 59646757
(3R,4S)-7-chloro-4-[2-(4-fluorophenyl)ethylamino]-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-3-ol (PubChem CID 59646757) has the molecular formula C23H24ClFN2O3 and a molecular weight of 430.91 g/mol. Its IUPAC name is (3R,4S)-7-chloro-4-[2-(4-fluorophenyl)ethylamino]-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-3-ol.
| Compound Name | (3R,4S)-7-chloro-4-[2-(4-fluorophenyl)ethylamino]-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-3-ol |
|---|---|
| PubChem CID | 59646757 |
| Molecular Formula | C23H24ClFN2O3 |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (3R,4S)-7-chloro-4-[2-(4-fluorophenyl)ethylamino]-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-3-ol |
| SMILES | Cc1cc(Cl)[n+]([O-])c2cc3c(cc12)OC(C)(C)[C@H](O)[C@H]3NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H24ClFN2O3/c1-13-10-20(24)27(29)18-11-17-19(12-16(13)18)30-23(2,3)22(28)21(17)26-9-8-14-4-6-15(25)7-5-14/h4-7,10-12,21-22,26,28H,8-9H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | YJGGNEJJOHFCPG-FCHUYYIVSA-N |
| XLogP | 3.98 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|