C19H18N2O3 — CID 59647495
8-(2-hydroxyethyl)-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione (PubChem CID 59647495) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 8-(2-hydroxyethyl)-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione.
| Compound Name | 8-(2-hydroxyethyl)-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione |
|---|---|
| PubChem CID | 59647495 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 8-(2-hydroxyethyl)-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione |
| SMILES | O=C1Nc2c(cc(-c3ccccc3)c3c2CN(CCO)CC3)C1=O |
| InChI | InChI=1S/C19H18N2O3/c22-9-8-21-7-6-13-14(12-4-2-1-3-5-12)10-15-17(16(13)11-21)20-19(24)18(15)23/h1-5,10,22H,6-9,11H2,(H,20,23,24) |
| InChIKey | ZICMJKAIDWSRHJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|