C19H22F3NO5 — CID 59648090
dimethyl (2R,3S)-2-prop-2-enyl-3-[4-(trifluoromethyl)phenoxy]piperidine-1,3-dicarboxylate (PubChem CID 59648090) has the molecular formula C19H22F3NO5 and a molecular weight of 401.38 g/mol. Its IUPAC name is dimethyl (2R,3S)-2-prop-2-enyl-3-[4-(trifluoromethyl)phenoxy]piperidine-1,3-dicarboxylate.
| Compound Name | dimethyl (2R,3S)-2-prop-2-enyl-3-[4-(trifluoromethyl)phenoxy]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59648090 |
| Molecular Formula | C19H22F3NO5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | dimethyl (2R,3S)-2-prop-2-enyl-3-[4-(trifluoromethyl)phenoxy]piperidine-1,3-dicarboxylate |
| SMILES | C=CC[C@H]1N(C(=O)OC)CCC[C@@]1(Oc1ccc(C(F)(F)F)cc1)C(=O)OC |
| InChI | InChI=1S/C19H22F3NO5/c1-4-6-15-18(16(24)26-2,11-5-12-23(15)17(25)27-3)28-14-9-7-13(8-10-14)19(20,21)22/h4,7-10,15H,1,5-6,11-12H2,2-3H3/t15-,18+/m1/s1 |
| InChIKey | BOSULQSEWWNBDP-QAPCUYQASA-N |
| XLogP | 3.80 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|