About [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid
[3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid (PubChem CID 59648165) has the molecular formula C6H10BNO4
and a molecular weight of 170.96 g/mol. Its IUPAC name is [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid.
Molecular Properties
| Compound Name | [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid |
| PubChem CID | 59648165 |
| Molecular Formula | C6H10BNO4 |
| Molecular Weight | 170.96 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid |
| SMILES | COCc1noc(C)c1B(O)O |
| InChI | InChI=1S/C6H10BNO4/c1-4-6(7(9)10)5(3-11-2)8-12-4/h9-10H,3H2,1-2H3 |
| InChIKey | OFDMWBIEGDCUKQ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.96 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid?
The IUPAC name of [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid (CID 59648165) is [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid.
What is the SMILES notation for [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid?
The canonical SMILES for [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid is COCc1noc(C)c1B(O)O.
What is the InChIKey of [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid?
The InChIKey is OFDMWBIEGDCUKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BNO4/c1-4-6(7(9)10)5(3-11-2)8-12-4/h9-10H,3H2,1-2H3.
What are the key properties of [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid?
[3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid has a molecular weight of 170.96 g/mol, XLogP of -1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methoxymethyl)-5-methyl-1,2-oxazol-4-yl]boronic acid is sourced from PubChem (CID 59648165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).