About N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide
N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide (PubChem CID 59648255) has the molecular formula C22H28Cl2N4O2S
and a molecular weight of 483.47 g/mol. Its IUPAC name is N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide |
| PubChem CID | 59648255 |
| Molecular Formula | C22H28Cl2N4O2S |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc2c(c1)c(N(CC)CC)nn2Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H28Cl2N4O2S/c1-5-15(4)26-31(29,30)16-11-12-21-17(13-16)22(27(6-2)7-3)25-28(21)14-18-19(23)9-8-10-20(18)24/h8-13,15,26H,5-7,14H2,1-4H3 |
| InChIKey | YJSFMVUYFIYKIY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide?
The IUPAC name of N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide (CID 59648255) is N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide.
What is the SMILES notation for N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide?
The canonical SMILES for N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide is CCC(C)NS(=O)(=O)c1ccc2c(c1)c(N(CC)CC)nn2Cc1c(Cl)cccc1Cl.
What is the InChIKey of N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide?
The InChIKey is YJSFMVUYFIYKIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28Cl2N4O2S/c1-5-15(4)26-31(29,30)16-11-12-21-17(13-16)22(27(6-2)7-3)25-28(21)14-18-19(23)9-8-10-20(18)24/h8-13,15,26H,5-7,14H2,1-4H3.
What are the key properties of N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide?
N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide has a molecular weight of 483.47 g/mol, XLogP of 5.31, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-1-[(2,6-dichlorophenyl)methyl]-3-(diethylamino)indazole-5-sulfonamide is sourced from PubChem (CID 59648255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).