About potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate
potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate (PubChem CID 59648687) has the molecular formula C8H7KN2O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 59648687 |
| Molecular Formula | C8H7KN2O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate |
| SMILES | Cn1ccc2[nH]c(C(=O)[O-])cc21.[K+] |
| InChI | InChI=1S/C8H8N2O2.K/c1-10-3-2-5-7(10)4-6(9-5)8(11)12;/h2-4,9H,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | SFTRZXKYZFWBAW-UHFFFAOYSA-M |
| XLogP | -3.13 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate (CID 59648687) is potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate is Cn1ccc2[nH]c(C(=O)[O-])cc21.[K+].
What is the InChIKey of potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate?
The InChIKey is SFTRZXKYZFWBAW-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8N2O2.K/c1-10-3-2-5-7(10)4-6(9-5)8(11)12;/h2-4,9H,1H3,(H,11,12);/q;+1/p-1.
What are the key properties of potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate?
potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate has a molecular weight of 202.25 g/mol, XLogP of -3.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1-methyl-4H-pyrrolo[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 59648687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).