About [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate
[1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate (PubChem CID 59648744) has the molecular formula C17H28O8
and a molecular weight of 360.40 g/mol. Its IUPAC name is [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate.
Molecular Properties
| Compound Name | [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate |
| PubChem CID | 59648744 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate |
| SMILES | C=C(CC(C)=O)C(=O)OC(C)C(=O)OCC(COC)(COC)COC |
| InChI | InChI=1S/C17H28O8/c1-12(7-13(2)18)15(19)25-14(3)16(20)24-11-17(8-21-4,9-22-5)10-23-6/h14H,1,7-11H2,2-6H3 |
| InChIKey | XZBANSRPIUMSQT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate?
The IUPAC name of [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate (CID 59648744) is [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate.
What is the SMILES notation for [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate?
The canonical SMILES for [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate is C=C(CC(C)=O)C(=O)OC(C)C(=O)OCC(COC)(COC)COC.
What is the InChIKey of [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate?
The InChIKey is XZBANSRPIUMSQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O8/c1-12(7-13(2)18)15(19)25-14(3)16(20)24-11-17(8-21-4,9-22-5)10-23-6/h14H,1,7-11H2,2-6H3.
What are the key properties of [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate?
[1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate has a molecular weight of 360.40 g/mol, XLogP of 0.92, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-methoxy-2,2-bis(methoxymethyl)propoxy]-1-oxopropan-2-yl] 2-methylidene-4-oxopentanoate is sourced from PubChem (CID 59648744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).