C21H14F5N3S — CID 59648800
2-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-enylidene]propanedinitrile (PubChem CID 59648800) has the molecular formula C21H14F5N3S and a molecular weight of 435.42 g/mol. Its IUPAC name is 2-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 59648800 |
| Molecular Formula | C21H14F5N3S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 2-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-enylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C(/C=C/c1ccc(N2CCCCC2)s1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H14F5N3S/c22-17-16(18(23)20(25)21(26)19(17)24)14(12(10-27)11-28)6-4-13-5-7-15(30-13)29-8-2-1-3-9-29/h4-7H,1-3,8-9H2/b6-4+ |
| InChIKey | XDGILYDIHHYXFB-GQCTYLIASA-N |
| XLogP | 5.95 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|