C23H17F6N3O2S — CID 59648838
(5E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 59648838) has the molecular formula C23H17F6N3O2S and a molecular weight of 513.46 g/mol. Its IUPAC name is (5E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 59648838 |
| Molecular Formula | C23H17F6N3O2S |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | (5E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN(C)c1ccc(/C=C/C=C2\C(=O)NC(=S)N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H17F6N3O2S/c1-31(2)16-8-6-13(7-9-16)4-3-5-18-19(33)30-21(35)32(20(18)34)17-11-14(22(24,25)26)10-15(12-17)23(27,28)29/h3-12H,1-2H3,(H,30,33,35)/b4-3+,18-5+ |
| InChIKey | VOMYZVFVPHVZIR-FKKWJZCKSA-N |
| XLogP | 5.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|