C8H9F3N2O3 — CID 59648904
1-ethyl-3-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 59648904) has the molecular formula C8H9F3N2O3 and a molecular weight of 238.16 g/mol. Its IUPAC name is 1-ethyl-3-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-ethyl-3-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59648904 |
| Molecular Formula | C8H9F3N2O3 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-ethyl-3-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)CC(=O)N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C8H9F3N2O3/c1-2-12-5(14)3-6(15)13(7(12)16)4-8(9,10)11/h2-4H2,1H3 |
| InChIKey | OKKWYZYJFFZSSB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|