C17H14N2O10 — CID 59648921
bis(2,5-dioxopyrrolidin-1-yl) (2E,7E)-4,6-dioxonona-2,7-dienedioate (PubChem CID 59648921) has the molecular formula C17H14N2O10 and a molecular weight of 406.30 g/mol. Its IUPAC name is bis(2,5-dioxopyrrolidin-1-yl) (2E,7E)-4,6-dioxonona-2,7-dienedioate.
| Compound Name | bis(2,5-dioxopyrrolidin-1-yl) (2E,7E)-4,6-dioxonona-2,7-dienedioate |
|---|---|
| PubChem CID | 59648921 |
| Molecular Formula | C17H14N2O10 |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | bis(2,5-dioxopyrrolidin-1-yl) (2E,7E)-4,6-dioxonona-2,7-dienedioate |
| SMILES | O=C(/C=C/C(=O)ON1C(=O)CCC1=O)CC(=O)/C=C/C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H14N2O10/c20-10(1-7-16(26)28-18-12(22)3-4-13(18)23)9-11(21)2-8-17(27)29-19-14(24)5-6-15(19)25/h1-2,7-8H,3-6,9H2/b7-1+,8-2+ |
| InChIKey | FYGSAGWDVNDQNE-FACPPWRESA-N |
| XLogP | -1.16 |
| TPSA | 161.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|