C12H22O — CID 59649291
2-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol (PubChem CID 59649291) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol.
| Compound Name | 2-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 59649291 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol |
| SMILES | CCC1(O)CCC2CCCCC2C1 |
| InChI | InChI=1S/C12H22O/c1-2-12(13)8-7-10-5-3-4-6-11(10)9-12/h10-11,13H,2-9H2,1H3 |
| InChIKey | VVTIHMHOQLUWQA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |