C18H21N — CID 59649507
(5R)-7-benzyl-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 59649507) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is (5R)-7-benzyl-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | (5R)-7-benzyl-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 59649507 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (5R)-7-benzyl-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | C[C@H]1CNCCc2ccc(Cc3ccccc3)cc21 |
| InChI | InChI=1S/C18H21N/c1-14-13-19-10-9-17-8-7-16(12-18(14)17)11-15-5-3-2-4-6-15/h2-8,12,14,19H,9-11,13H2,1H3/t14-/m0/s1 |
| InChIKey | OKGSYVHCSHUIEK-AWEZNQCLSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |