About CID 59649959
CID 59649959 (PubChem CID 59649959) has the molecular formula C15H21+
and a molecular weight of 201.33 g/mol.
Molecular Properties
| Compound Name | CID 59649959 |
| PubChem CID | 59649959 |
| Molecular Formula | C15H21+ |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | — |
| SMILES | CC12C[C+]3C4CC5CC3C(C1)C(C5)C4C2 |
| InChI | InChI=1S/C15H21/c1-15-5-12-9-2-8-3-10(12)14(7-15)11(4-8)13(9)6-15/h8-13H,2-7H2,1H3/q+1 |
| InChIKey | NDMBZADKSMUTEV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59649959 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59649959?
The IUPAC name of CID 59649959 (CID 59649959) is not available.
What is the SMILES notation for CID 59649959?
The canonical SMILES for CID 59649959 is CC12C[C+]3C4CC5CC3C(C1)C(C5)C4C2.
What is the InChIKey of CID 59649959?
The InChIKey is NDMBZADKSMUTEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21/c1-15-5-12-9-2-8-3-10(12)14(7-15)11(4-8)13(9)6-15/h8-13H,2-7H2,1H3/q+1.
What are the key properties of CID 59649959?
CID 59649959 has a molecular weight of 201.33 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59649959 is sourced from PubChem (CID 59649959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).