C18H15N7O7S2 — CID 59650162
2-[[6-(carboxymethylamino)-5-cyano-4-methyl-3-[[6-(trioxidanylsulfanyl)-1,3-benzothiazol-2-yl]diazenyl]-2-pyridinyl]amino]acetic acid (PubChem CID 59650162) has the molecular formula C18H15N7O7S2 and a molecular weight of 505.49 g/mol. Its IUPAC name is 2-[[6-(carboxymethylamino)-5-cyano-4-methyl-3-[[6-(trioxidanylsulfanyl)-1,3-benzothiazol-2-yl]diazenyl]-2-pyridinyl]amino]acetic acid.
| Compound Name | 2-[[6-(carboxymethylamino)-5-cyano-4-methyl-3-[[6-(trioxidanylsulfanyl)-1,3-benzothiazol-2-yl]diazenyl]-2-pyridinyl]amino]acetic acid |
|---|---|
| PubChem CID | 59650162 |
| Molecular Formula | C18H15N7O7S2 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | 2-[[6-(carboxymethylamino)-5-cyano-4-methyl-3-[[6-(trioxidanylsulfanyl)-1,3-benzothiazol-2-yl]diazenyl]-2-pyridinyl]amino]acetic acid |
| SMILES | Cc1c(C#N)c(NCC(=O)O)nc(NCC(=O)O)c1/N=N/c1nc2ccc(SOOO)cc2s1 |
| InChI | InChI=1S/C18H15N7O7S2/c1-8-10(5-19)16(20-6-13(26)27)23-17(21-7-14(28)29)15(8)24-25-18-22-11-3-2-9(34-32-31-30)4-12(11)33-18/h2-4,30H,6-7H2,1H3,(H,26,27)(H,28,29)(H2,20,21,23)/b25-24+ |
| InChIKey | GCPIYGHFHLOTMH-OCOZRVBESA-N |
| XLogP | 3.71 |
| TPSA | 211.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|