About [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide
[(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide (PubChem CID 59650203) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide.
Molecular Properties
| Compound Name | [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide |
| PubChem CID | 59650203 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide |
| SMILES | [C-]#[N+]/N=C1\C=C(C)/C(=N/C#N)C=C1C |
| InChI | InChI=1S/C10H8N4/c1-7-5-10(14-12-3)8(2)4-9(7)13-6-11/h4-5H,1-2H3/b13-9+,14-10+ |
| InChIKey | ODFDOYDVNHKJQO-UTLPMFLDSA-N |
| XLogP | 2.09 |
| TPSA | 52.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide?
The IUPAC name of [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide (CID 59650203) is [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide.
What is the SMILES notation for [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide?
The canonical SMILES for [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide is [C-]#[N+]/N=C1\C=C(C)/C(=N/C#N)C=C1C.
What is the InChIKey of [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide?
The InChIKey is ODFDOYDVNHKJQO-UTLPMFLDSA-N. The full InChI is InChI=1S/C10H8N4/c1-7-5-10(14-12-3)8(2)4-9(7)13-6-11/h4-5H,1-2H3/b13-9+,14-10+.
What are the key properties of [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide?
[(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide has a molecular weight of 184.20 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4E)-4-isocyanoimino-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide is sourced from PubChem (CID 59650203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).