C28H10F6N8O2 — CID 59650482
5-isocyano-10,11-diphenoxy-16,17-bis(trifluoromethyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8(13),9,11,15,17-nonaene-4-carbonitrile (PubChem CID 59650482) has the molecular formula C28H10F6N8O2 and a molecular weight of 604.43 g/mol. Its IUPAC name is 5-isocyano-10,11-diphenoxy-16,17-bis(trifluoromethyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8(13),9,11,15,17-nonaene-4-carbonitrile.
| Compound Name | 5-isocyano-10,11-diphenoxy-16,17-bis(trifluoromethyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8(13),9,11,15,17-nonaene-4-carbonitrile |
|---|---|
| PubChem CID | 59650482 |
| Molecular Formula | C28H10F6N8O2 |
| Molecular Weight | 604.43 g/mol |
| Exact Mass | 604.08 |
| IUPAC Name | 5-isocyano-10,11-diphenoxy-16,17-bis(trifluoromethyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8(13),9,11,15,17-nonaene-4-carbonitrile |
| SMILES | [C-]#[N+]c1nc2c(nc1C#N)c1nc(C(F)(F)F)c(C(F)(F)F)nc1c1nc(Oc3ccccc3)c(Oc3ccccc3)nc21 |
| InChI | InChI=1S/C28H10F6N8O2/c1-36-24-15(12-35)37-16-17-18(39-23(28(32,33)34)22(38-17)27(29,30)31)20-21(19(16)40-24)42-26(44-14-10-6-3-7-11-14)25(41-20)43-13-8-4-2-5-9-13/h2-11H |
| InChIKey | BUQVKIUAHQSOSO-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 123.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.43 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|