C42H22F6N6O4 — CID 59650494
4,5,10,11-tetraphenoxy-18,19-bis(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene (PubChem CID 59650494) has the molecular formula C42H22F6N6O4 and a molecular weight of 788.66 g/mol. Its IUPAC name is 4,5,10,11-tetraphenoxy-18,19-bis(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene.
| Compound Name | 4,5,10,11-tetraphenoxy-18,19-bis(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene |
|---|---|
| PubChem CID | 59650494 |
| Molecular Formula | C42H22F6N6O4 |
| Molecular Weight | 788.66 g/mol |
| Exact Mass | 788.16 |
| IUPAC Name | 4,5,10,11-tetraphenoxy-18,19-bis(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene |
| SMILES | FC(F)(F)c1cc2nc3c4nc(Oc5ccccc5)c(Oc5ccccc5)nc4c4nc(Oc5ccccc5)c(Oc5ccccc5)nc4c3nc2cc1C(F)(F)F |
| InChI | InChI=1S/C42H22F6N6O4/c43-41(44,45)27-21-29-30(22-28(27)42(46,47)48)50-32-31(49-29)33-35(53-39(57-25-17-9-3-10-18-25)37(51-33)55-23-13-5-1-6-14-23)36-34(32)52-38(56-24-15-7-2-8-16-24)40(54-36)58-26-19-11-4-12-20-26/h1-22H |
| InChIKey | FOEMOWFTLJURBZ-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.66 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|