C28H22N6O4 — CID 59650549
4,5,10,11-tetramethoxy-16,17-diphenyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8(13),9,11,15,17-nonaene (PubChem CID 59650549) has the molecular formula C28H22N6O4 and a molecular weight of 506.52 g/mol. Its IUPAC name is 4,5,10,11-tetramethoxy-16,17-diphenyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8(13),9,11,15,17-nonaene.
| Compound Name | 4,5,10,11-tetramethoxy-16,17-diphenyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8(13),9,11,15,17-nonaene |
|---|---|
| PubChem CID | 59650549 |
| Molecular Formula | C28H22N6O4 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 4,5,10,11-tetramethoxy-16,17-diphenyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8(13),9,11,15,17-nonaene |
| SMILES | COc1nc2c3nc(OC)c(OC)nc3c3nc(-c4ccccc4)c(-c4ccccc4)nc3c2nc1OC |
| InChI | InChI=1S/C28H22N6O4/c1-35-25-27(37-3)33-23-21(31-25)19-20(22-24(23)34-28(38-4)26(32-22)36-2)30-18(16-13-9-6-10-14-16)17(29-19)15-11-7-5-8-12-15/h5-14H,1-4H3 |
| InChIKey | RCUCHLZIFYDRHJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|