C20H26F3N5O — CID 59650679
(3R)-3-amino-1-[(2S)-2-(1-tert-butyl-1,2,4-triazol-3-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 59650679) has the molecular formula C20H26F3N5O and a molecular weight of 409.46 g/mol. Its IUPAC name is (3R)-3-amino-1-[(2S)-2-(1-tert-butyl-1,2,4-triazol-3-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[(2S)-2-(1-tert-butyl-1,2,4-triazol-3-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 59650679 |
| Molecular Formula | C20H26F3N5O |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (3R)-3-amino-1-[(2S)-2-(1-tert-butyl-1,2,4-triazol-3-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | CC(C)(C)n1cnc([C@@H]2CCCN2C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C20H26F3N5O/c1-20(2,3)28-11-25-19(26-28)17-5-4-6-27(17)18(29)9-13(24)7-12-8-15(22)16(23)10-14(12)21/h8,10-11,13,17H,4-7,9,24H2,1-3H3/t13-,17+/m1/s1 |
| InChIKey | MYUVFGFWYHLENE-DYVFJYSZSA-N |
| XLogP | 3.07 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|