About methyl 4-iodo-3-methylbutanoate
methyl 4-iodo-3-methylbutanoate (PubChem CID 59650925) has the molecular formula C6H11IO2
and a molecular weight of 242.06 g/mol. Its IUPAC name is methyl 4-iodo-3-methylbutanoate.
Molecular Properties
| Compound Name | methyl 4-iodo-3-methylbutanoate |
| PubChem CID | 59650925 |
| Molecular Formula | C6H11IO2 |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | methyl 4-iodo-3-methylbutanoate |
| SMILES | COC(=O)CC(C)CI |
| InChI | InChI=1S/C6H11IO2/c1-5(4-7)3-6(8)9-2/h5H,3-4H2,1-2H3 |
| InChIKey | GTAQNWMOSZBMDT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-iodo-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-iodo-3-methylbutanoate?
The IUPAC name of methyl 4-iodo-3-methylbutanoate (CID 59650925) is methyl 4-iodo-3-methylbutanoate.
What is the SMILES notation for methyl 4-iodo-3-methylbutanoate?
The canonical SMILES for methyl 4-iodo-3-methylbutanoate is COC(=O)CC(C)CI.
What is the InChIKey of methyl 4-iodo-3-methylbutanoate?
The InChIKey is GTAQNWMOSZBMDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11IO2/c1-5(4-7)3-6(8)9-2/h5H,3-4H2,1-2H3.
What are the key properties of methyl 4-iodo-3-methylbutanoate?
methyl 4-iodo-3-methylbutanoate has a molecular weight of 242.06 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-iodo-3-methylbutanoate is sourced from PubChem (CID 59650925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).