About 2-amino-5-oxohexanal
2-amino-5-oxohexanal (PubChem CID 59651251) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-amino-5-oxohexanal.
Molecular Properties
| Compound Name | 2-amino-5-oxohexanal |
| PubChem CID | 59651251 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 2-amino-5-oxohexanal |
| SMILES | CC(=O)CCC(N)C=O |
| InChI | InChI=1S/C6H11NO2/c1-5(9)2-3-6(7)4-8/h4,6H,2-3,7H2,1H3 |
| InChIKey | AGDLHGMMANUOIB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-oxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-oxohexanal?
The IUPAC name of 2-amino-5-oxohexanal (CID 59651251) is 2-amino-5-oxohexanal.
What is the SMILES notation for 2-amino-5-oxohexanal?
The canonical SMILES for 2-amino-5-oxohexanal is CC(=O)CCC(N)C=O.
What is the InChIKey of 2-amino-5-oxohexanal?
The InChIKey is AGDLHGMMANUOIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-5(9)2-3-6(7)4-8/h4,6H,2-3,7H2,1H3.
What are the key properties of 2-amino-5-oxohexanal?
2-amino-5-oxohexanal has a molecular weight of 129.16 g/mol, XLogP of -0.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-oxohexanal is sourced from PubChem (CID 59651251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).