C16H12N2O8S2 — CID 59651291
3-oxo-2-[3-oxo-5-(trioxidanylsulfanyl)-1,2-dihydroindol-2-yl]-1,2-dihydroindole-5-sulfonic acid (PubChem CID 59651291) has the molecular formula C16H12N2O8S2 and a molecular weight of 424.41 g/mol. Its IUPAC name is 3-oxo-2-[3-oxo-5-(trioxidanylsulfanyl)-1,2-dihydroindol-2-yl]-1,2-dihydroindole-5-sulfonic acid.
| Compound Name | 3-oxo-2-[3-oxo-5-(trioxidanylsulfanyl)-1,2-dihydroindol-2-yl]-1,2-dihydroindole-5-sulfonic acid |
|---|---|
| PubChem CID | 59651291 |
| Molecular Formula | C16H12N2O8S2 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 3-oxo-2-[3-oxo-5-(trioxidanylsulfanyl)-1,2-dihydroindol-2-yl]-1,2-dihydroindole-5-sulfonic acid |
| SMILES | O=C1c2cc(SOOO)ccc2NC1C1Nc2ccc(S(=O)(=O)O)cc2C1=O |
| InChI | InChI=1S/C16H12N2O8S2/c19-15-9-5-7(27-26-25-21)1-3-11(9)17-13(15)14-16(20)10-6-8(28(22,23)24)2-4-12(10)18-14/h1-6,13-14,17-18,21H,(H,22,23,24) |
| InChIKey | RRTSXUSVNMWRBD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|