C8H16O3S — CID 59651583
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-4,6-dimethylthiane-3,5-diol (PubChem CID 59651583) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-4,6-dimethylthiane-3,5-diol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-4,6-dimethylthiane-3,5-diol |
|---|---|
| PubChem CID | 59651583 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-4,6-dimethylthiane-3,5-diol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](C)S[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C8H16O3S/c1-4-7(10)5(2)12-6(3-9)8(4)11/h4-11H,3H2,1-2H3/t4-,5+,6-,7-,8+/m1/s1 |
| InChIKey | DRMBBLKAJNUUHR-UOLFYFMNSA-N |
| XLogP | -0.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |