C9H18O4S — CID 59651599
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-propan-2-ylthiane-3,4,5-triol (PubChem CID 59651599) has the molecular formula C9H18O4S and a molecular weight of 222.31 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-propan-2-ylthiane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-propan-2-ylthiane-3,4,5-triol |
|---|---|
| PubChem CID | 59651599 |
| Molecular Formula | C9H18O4S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-propan-2-ylthiane-3,4,5-triol |
| SMILES | CC(C)[C@@H]1S[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H18O4S/c1-4(2)9-8(13)7(12)6(11)5(3-10)14-9/h4-13H,3H2,1-2H3/t5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | BUPXVKNRJXDGJZ-ZEBDFXRSSA-N |
| XLogP | -0.80 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |