About 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one
7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 59652099) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one.
Molecular Properties
| Compound Name | 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one |
| PubChem CID | 59652099 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | CC1=CN2C=CN=CC2C(=O)N1 |
| InChI | InChI=1S/C8H9N3O/c1-6-5-11-3-2-9-4-7(11)8(12)10-6/h2-5,7H,1H3,(H,10,12) |
| InChIKey | PPLWMUQUQIDEIO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one?
The IUPAC name of 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one (CID 59652099) is 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one.
What is the SMILES notation for 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one?
The canonical SMILES for 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one is CC1=CN2C=CN=CC2C(=O)N1.
What is the InChIKey of 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one?
The InChIKey is PPLWMUQUQIDEIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-6-5-11-3-2-9-4-7(11)8(12)10-6/h2-5,7H,1H3,(H,10,12).
What are the key properties of 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one?
7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one has a molecular weight of 163.18 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-8,9a-dihydropyrazino[1,2-a]pyrazin-9-one is sourced from PubChem (CID 59652099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).