C22H21N5O4S — CID 59652804
2-(1,3-dioxoisoindol-2-yl)-N-[1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindol-6-yl]ethanesulfonamide (PubChem CID 59652804) has the molecular formula C22H21N5O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindol-6-yl]ethanesulfonamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindol-6-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 59652804 |
| Molecular Formula | C22H21N5O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindol-6-yl]ethanesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)Nc1ccc2c(c1)N(Cc1cnc[nH]1)CC2 |
| InChI | InChI=1S/C22H21N5O4S/c28-21-18-3-1-2-4-19(18)22(29)27(21)9-10-32(30,31)25-16-6-5-15-7-8-26(20(15)11-16)13-17-12-23-14-24-17/h1-6,11-12,14,25H,7-10,13H2,(H,23,24) |
| InChIKey | LZZDLKBHXCKENI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|